CAS 2836333-40-3 is the registry number for 2-(3-(Azidomethyl)-2-formyl-6-methylphenoxy)acetic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[3-(azidomethyl)-2-formyl-6-methylphenoxy]acetic acid (CAS 2836333-40-3) is a chemical compound with the molecular formula C11H11N3O4 and a molecular weight of 249.22 g/mol. IUPAC name: 2-[3-(azidomethyl)-2-formyl-6-methylphenoxy]acetic acid. InChIKey: DNAWKYSZLKWQCM-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O4 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | 2-[3-(azidomethyl)-2-formyl-6-methylphenoxy]acetic acid |
| InChIKey | DNAWKYSZLKWQCM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)CN=[N+]=[N-])C=O)OCC(=O)O |
Computed by PubChem (NCBI)