Products 2836333-40-3

CAS 2836333-40-3 is the registry number for 2-(3-(Azidomethyl)-2-formyl-6-methylphenoxy)acetic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

2-[3-(azidomethyl)-2-formyl-6-methylphenoxy]acetic acid (CAS 2836333-40-3) is a chemical compound with the molecular formula C11H11N3O4 and a molecular weight of 249.22 g/mol. IUPAC name: 2-[3-(azidomethyl)-2-formyl-6-methylphenoxy]acetic acid. InChIKey: DNAWKYSZLKWQCM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11N3O4
Molecular weight249.22 g/mol
IUPAC name2-[3-(azidomethyl)-2-formyl-6-methylphenoxy]acetic acid
InChIKeyDNAWKYSZLKWQCM-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C=C1)CN=[N+]=[N-])C=O)OCC(=O)O

Computed by PubChem (NCBI)

Synonyms: orb3181733