Products 28384-44-3
CAS 28384-44-3 is the registry number for Clausenidin. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-hydroxy-2,2-dimethyl-10-(2-methylbut-3-en-2-yl)-3H-pyrano[3,2-g]chromene-4,8-dione (CAS 28384-44-3) is a chemical compound with the molecular formula C19H20O5 and a molecular weight of 328.4 g/mol. IUPAC name: 5-hydroxy-2,2-dimethyl-10-(2-methylbut-3-en-2-yl)-3H-pyrano[3,2-g]chromene-4,8-dione. InChIKey: RDROOFQFFWIIDK-UHFFFAOYSA-N.
| Molecular formula | C19H20O5 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | 5-hydroxy-2,2-dimethyl-10-(2-methylbut-3-en-2-yl)-3H-pyrano[3,2-g]chromene-4,8-dione |
| InChIKey | RDROOFQFFWIIDK-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=C(O1)C(=C3C(=C2O)C=CC(=O)O3)C(C)(C)C=C)C |
Computed by PubChem (NCBI)