CAS 28394-58-3 appears in our catalog under these names: Ethyl 3,4–dichlorobenzoate, Ethyl 3,4-dichlorobenzoate 98%, Benzoic acid, 3,4-dichloro-, ethyl ester, 98%, 98%, Ethyl 3,4-dichlorobenzoate, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 500g, 1g, 5g, 25g, 10g, 50g, 75g.
Ethyl 3,4-dichlorobenzoate (CAS 28394-58-3) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: ethyl 3,4-dichlorobenzoate. InChIKey: YONQPSPHUKKUEJ-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2 |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | ethyl 3,4-dichlorobenzoate |
| InChIKey | YONQPSPHUKKUEJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)