Products 28449-62-9
CAS 28449-62-9 is the registry number for Tomentin. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-hydroxy-6,7-dimethoxychromen-2-one (CAS 28449-62-9) is a chemical compound with the molecular formula C11H10O5 and a molecular weight of 222.19 g/mol. IUPAC name: 5-hydroxy-6,7-dimethoxychromen-2-one. InChIKey: KCPNDUHAXDHRKX-UHFFFAOYSA-N.
| Molecular formula | C11H10O5 |
|---|---|
| Molecular weight | 222.19 g/mol |
| IUPAC name | 5-hydroxy-6,7-dimethoxychromen-2-one |
| InChIKey | KCPNDUHAXDHRKX-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C=CC(=O)OC2=C1)O)OC |
Computed by PubChem (NCBI)