CAS 284493-58-9 appears in our catalog under these names: Boc-β-DL-Phe(3-Br)-OH 97%, 3-(3-Bromophenyl)-3-((tert-butoxycarbonyl)amino)propanoic acid, 97%, 97%, 3-(3-Bromophenyl)-3-((tert-butoxycarbonyl)amino)propanoic acid, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
3-(3-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 284493-58-9) is a chemical compound with the molecular formula C14H18BrNO4 and a molecular weight of 344.20 g/mol. IUPAC name: 3-(3-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: UTYRIGRZLZNTLR-UHFFFAOYSA-N.
| Molecular formula | C14H18BrNO4 |
|---|---|
| Molecular weight | 344.20 g/mol |
| IUPAC name | 3-(3-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | UTYRIGRZLZNTLR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)