CAS 284493-60-3 appears in our catalog under these names: 3-((tert-Butoxycarbonyl)amino)-3-(p-tolyl)propanoic acid, 95%, 3-((tert-Butoxycarbonyl)amino)-3-(p-tolyl)propanoic acid, 98%, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 250mg, 1g.
3-(4-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 284493-60-3) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: 3-(4-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: MBWMIEZHOLGJBM-UHFFFAOYSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | 3-(4-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | MBWMIEZHOLGJBM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)