Products 2845127-12-8
CAS 2845127-12-8 is the registry number for 1-(4-Aminophenyl)-3-oxocyclobutane-1-carboxylic acid hydrochloride, 95%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 100mg, 250mg, 50mg.
1-(4-aminophenyl)-3-oxocyclobutane-1-carboxylic acid;hydrochloride (CAS 2845127-12-8) is a chemical compound with the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. IUPAC name: 1-(4-aminophenyl)-3-oxocyclobutane-1-carboxylic acid;hydrochloride. InChIKey: FFYDKKBMUKJNLK-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO3 |
|---|---|
| Molecular weight | 241.67 g/mol |
| IUPAC name | 1-(4-aminophenyl)-3-oxocyclobutane-1-carboxylic acid;hydrochloride |
| InChIKey | FFYDKKBMUKJNLK-UHFFFAOYSA-N |
| SMILES | C1C(=O)CC1(C2=CC=C(C=C2)N)C(=O)O.Cl |
Computed by PubChem (NCBI)