Products 2845128-67-6
CAS 2845128-67-6 is the registry number for Methyl 2,3-Dihydrobenzisothiazole-6-carboxylate 1,1-Dioxide, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 1,1-dioxo-2,3-dihydro-1,2-benzothiazole-6-carboxylate (CAS 2845128-67-6) is a chemical compound with the molecular formula C9H9NO4S and a molecular weight of 227.24 g/mol. IUPAC name: methyl 1,1-dioxo-2,3-dihydro-1,2-benzothiazole-6-carboxylate. InChIKey: BDIWCYJZOZIKIO-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4S |
|---|---|
| Molecular weight | 227.24 g/mol |
| IUPAC name | methyl 1,1-dioxo-2,3-dihydro-1,2-benzothiazole-6-carboxylate |
| InChIKey | BDIWCYJZOZIKIO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(CNS2(=O)=O)C=C1 |
Computed by PubChem (NCBI)