Products 2845156-13-8
CAS 2845156-13-8 is the registry number for 2,2'-((3-Fluoro-5-nitrophenyl)methylene)bis(1H-pyrrole), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3-fluoro-5-nitrophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole (CAS 2845156-13-8) is a chemical compound with the molecular formula C15H12FN3O2 and a molecular weight of 285.27 g/mol. IUPAC name: 2-[(3-fluoro-5-nitrophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole. InChIKey: WKGVUJYFWFHGNT-UHFFFAOYSA-N.
| Molecular formula | C15H12FN3O2 |
|---|---|
| Molecular weight | 285.27 g/mol |
| IUPAC name | 2-[(3-fluoro-5-nitrophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrole |
| InChIKey | WKGVUJYFWFHGNT-UHFFFAOYSA-N |
| SMILES | C1=CNC(=C1)C(C2=CC=CN2)C3=CC(=CC(=C3)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)