CAS 606093-59-8 is the registry number for Methyl 7-fluoro-6-(phenylamino)-1H-benzo[d]imidazole-5-carboxylate, 95+%, 95+%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
Methyl 6-anilino-7-fluoro-3H-benzimidazole-5-carboxylate (CAS 606093-59-8) is a chemical compound with the molecular formula C15H12FN3O2 and a molecular weight of 285.27 g/mol. IUPAC name: methyl 6-anilino-7-fluoro-3H-benzimidazole-5-carboxylate. InChIKey: UXVBXDVPFGJBJT-UHFFFAOYSA-N.
| Molecular formula | C15H12FN3O2 |
|---|---|
| Molecular weight | 285.27 g/mol |
| IUPAC name | methyl 6-anilino-7-fluoro-3H-benzimidazole-5-carboxylate |
| InChIKey | UXVBXDVPFGJBJT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C(=C1NC3=CC=CC=C3)F)N=CN2 |
Computed by PubChem (NCBI)