CAS 893645-69-7 is the registry number for 1-(4-Fluorophenyl)-3,6-dimethyl-1H-pyrazolo(3,4-b)pyridine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(4-fluorophenyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylic acid (CAS 893645-69-7) is a chemical compound with the molecular formula C15H12FN3O2 and a molecular weight of 285.27 g/mol. IUPAC name: 1-(4-fluorophenyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylic acid. InChIKey: PANIZACEQJWOTI-UHFFFAOYSA-N.
| Molecular formula | C15H12FN3O2 |
|---|---|
| Molecular weight | 285.27 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylic acid |
| InChIKey | PANIZACEQJWOTI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=NN(C2=N1)C3=CC=C(C=C3)F)C)C(=O)O |
Computed by PubChem (NCBI)