CAS 937606-32-1 is the registry number for 2-(4-(4-Fluorophenyl)-3-methyl-1H-pyrazolo(3,4-b)pyridin-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-[4-(4-fluorophenyl)-3-methylpyrazolo[3,4-b]pyridin-1-yl]acetic acid (CAS 937606-32-1) is a chemical compound with the molecular formula C15H12FN3O2 and a molecular weight of 285.27 g/mol. IUPAC name: 2-[4-(4-fluorophenyl)-3-methylpyrazolo[3,4-b]pyridin-1-yl]acetic acid. InChIKey: FTMYLQKWGKDTBG-UHFFFAOYSA-N.
| Molecular formula | C15H12FN3O2 |
|---|---|
| Molecular weight | 285.27 g/mol |
| IUPAC name | 2-[4-(4-fluorophenyl)-3-methylpyrazolo[3,4-b]pyridin-1-yl]acetic acid |
| InChIKey | FTMYLQKWGKDTBG-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=NC=CC(=C12)C3=CC=C(C=C3)F)CC(=O)O |
Computed by PubChem (NCBI)