CAS 2866323-20-6 is the registry number for 4-(1,5-Dimethyl-1H-pyrazol-4-yl)-8-fluoroquinoline-2-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
4-(1,5-dimethylpyrazol-4-yl)-8-fluoroquinoline-2-carboxylic acid (CAS 2866323-20-6) is a chemical compound with the molecular formula C15H12FN3O2 and a molecular weight of 285.27 g/mol. IUPAC name: 4-(1,5-dimethylpyrazol-4-yl)-8-fluoroquinoline-2-carboxylic acid. InChIKey: DHWVYNZQUNMGFR-UHFFFAOYSA-N.
| Molecular formula | C15H12FN3O2 |
|---|---|
| Molecular weight | 285.27 g/mol |
| IUPAC name | 4-(1,5-dimethylpyrazol-4-yl)-8-fluoroquinoline-2-carboxylic acid |
| InChIKey | DHWVYNZQUNMGFR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C)C2=CC(=NC3=C2C=CC=C3F)C(=O)O |
Computed by PubChem (NCBI)