Products 2847776-03-6
CAS 2847776-03-6 is the registry number for Naftifine N-Oxide. Offered by: Biosynth. Available pack sizes: 50mg, 100mg.
(E)-N-methyl-N-(naphthalen-1-ylmethyl)-3-phenylprop-2-en-1-amine oxide (CAS 2847776-03-6) is a chemical compound with the molecular formula C21H21NO and a molecular weight of 303.4 g/mol. IUPAC name: (E)-N-methyl-N-(naphthalen-1-ylmethyl)-3-phenylprop-2-en-1-amine oxide. InChIKey: TXWSGCANZDDBFA-DHZHZOJOSA-N.
| Molecular formula | C21H21NO |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | (E)-N-methyl-N-(naphthalen-1-ylmethyl)-3-phenylprop-2-en-1-amine oxide |
| InChIKey | TXWSGCANZDDBFA-DHZHZOJOSA-N |
| SMILES | C[N+](C/C=C/C1=CC=CC=C1)(CC2=CC=CC3=CC=CC=C32)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Naftifine N-Oxide (~90%), Naftifine N-Oxide