CAS 2847885-46-3 is the registry number for 4-Fluoro-6-(hydroxymethyl)isoindolin-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-fluoro-6-(hydroxymethyl)-2,3-dihydroisoindol-1-one (CAS 2847885-46-3) is a chemical compound with the molecular formula C9H8FNO2 and a molecular weight of 181.16 g/mol. IUPAC name: 4-fluoro-6-(hydroxymethyl)-2,3-dihydroisoindol-1-one. InChIKey: NIQJLLFZCHWVHA-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO2 |
|---|---|
| Molecular weight | 181.16 g/mol |
| IUPAC name | 4-fluoro-6-(hydroxymethyl)-2,3-dihydroisoindol-1-one |
| InChIKey | NIQJLLFZCHWVHA-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2F)CO)C(=O)N1 |
Computed by PubChem (NCBI)