CAS 2854-09-3 is the registry number for 1-(2-Hydroxyethyl)-5-nitro-1H-pyrrole-2-carboxamide, N/A, N/A. Offered by: Chemat. Available pack sizes: 1kg.
1-(2-hydroxyethyl)-5-nitropyrrole-2-carboxamide (CAS 2854-09-3) is a chemical compound with the molecular formula C7H9N3O4 and a molecular weight of 199.16 g/mol. IUPAC name: 1-(2-hydroxyethyl)-5-nitropyrrole-2-carboxamide. InChIKey: RFQOPUYDLCMQCE-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O4 |
|---|---|
| Molecular weight | 199.16 g/mol |
| IUPAC name | 1-(2-hydroxyethyl)-5-nitropyrrole-2-carboxamide |
| InChIKey | RFQOPUYDLCMQCE-UHFFFAOYSA-N |
| SMILES | C1=C(N(C(=C1)[N+](=O)[O-])CCO)C(=O)N |
Computed by PubChem (NCBI)