Products 285566-16-7
CAS 285566-16-7 appears in our catalog under these names: 2-(Phenoxymethyl)-1,3-thiazole-4-carboxylic acid, 2-(Phenoxymethyl)thiazole-4-carboxylic acid, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 1g, 100mg, 250mg.
2-(phenoxymethyl)-1,3-thiazole-4-carboxylic acid (CAS 285566-16-7) is a chemical compound with the molecular formula C11H9NO3S and a molecular weight of 235.26 g/mol. IUPAC name: 2-(phenoxymethyl)-1,3-thiazole-4-carboxylic acid. InChIKey: LJOUWCZLNURASK-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3S |
|---|---|
| Molecular weight | 235.26 g/mol |
| IUPAC name | 2-(phenoxymethyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | LJOUWCZLNURASK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)