Products 286017-70-7

CAS 286017-70-7 is the registry number for 3'-iso-Propoxy-2,2,2-trifluoroacetophenone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2,2,2-trifluoro-1-(3-propan-2-yloxyphenyl)ethanone (CAS 286017-70-7) is a chemical compound with the molecular formula C11H11F3O2 and a molecular weight of 232.20 g/mol. IUPAC name: 2,2,2-trifluoro-1-(3-propan-2-yloxyphenyl)ethanone. InChIKey: GRGNWXUHGZOLKF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11F3O2
Molecular weight232.20 g/mol
IUPAC name2,2,2-trifluoro-1-(3-propan-2-yloxyphenyl)ethanone
InChIKeyGRGNWXUHGZOLKF-UHFFFAOYSA-N
SMILESCC(C)OC1=CC=CC(=C1)C(=O)C(F)(F)F

Computed by PubChem (NCBI)