Products 286017-71-8
CAS 286017-71-8 appears in our catalog under these names: 4'-Chloro-3'-methyl-2,2,2-trifluoroacetophenone, ≥95%, 1-(4-Chloro-3-methylphenyl)-2,2,2-trifluoroethanone, ≥95%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g.
1-(4-chloro-3-methylphenyl)-2,2,2-trifluoroethanone (CAS 286017-71-8) is a chemical compound with the molecular formula C9H6ClF3O and a molecular weight of 222.59 g/mol. IUPAC name: 1-(4-chloro-3-methylphenyl)-2,2,2-trifluoroethanone. InChIKey: ZJBYBUSSCVQOMY-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O |
|---|---|
| Molecular weight | 222.59 g/mol |
| IUPAC name | 1-(4-chloro-3-methylphenyl)-2,2,2-trifluoroethanone |
| InChIKey | ZJBYBUSSCVQOMY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)