CAS 2860564-31-2 is the registry number for 1H-Pyrazolo[3,4-b]pyrazine-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1H-pyrazolo[3,4-b]pyrazine-5-carboxylic acid (CAS 2860564-31-2) is a chemical compound with the molecular formula C6H4N4O2 and a molecular weight of 164.12 g/mol. IUPAC name: 1H-pyrazolo[3,4-b]pyrazine-5-carboxylic acid. InChIKey: MFAQPEHYQAGIKR-UHFFFAOYSA-N.
| Molecular formula | C6H4N4O2 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 1H-pyrazolo[3,4-b]pyrazine-5-carboxylic acid |
| InChIKey | MFAQPEHYQAGIKR-UHFFFAOYSA-N |
| SMILES | C1=C(N=C2C=NNC2=N1)C(=O)O |
Computed by PubChem (NCBI)