Products 2860564-31-2

CAS 2860564-31-2 is the registry number for 1H-Pyrazolo[3,4-b]pyrazine-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1H-pyrazolo[3,4-b]pyrazine-5-carboxylic acid (CAS 2860564-31-2) is a chemical compound with the molecular formula C6H4N4O2 and a molecular weight of 164.12 g/mol. IUPAC name: 1H-pyrazolo[3,4-b]pyrazine-5-carboxylic acid. InChIKey: MFAQPEHYQAGIKR-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4N4O2
Molecular weight164.12 g/mol
IUPAC name1H-pyrazolo[3,4-b]pyrazine-5-carboxylic acid
InChIKeyMFAQPEHYQAGIKR-UHFFFAOYSA-N
SMILESC1=C(N=C2C=NNC2=N1)C(=O)O

Computed by PubChem (NCBI)