Products 286460-74-0
CAS 286460-74-0 is the registry number for Fmoc-L-Val-OH-1-13C. Offered by: MedChemExpress. Available pack sizes: 25 mg, 100 mg, 50 mg, 250 mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl(113C)butanoic acid (CAS 286460-74-0) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 340.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl(113C)butanoic acid. InChIKey: UGNIYGNGCNXHTR-ZLHLYFPTSA-N.
| Molecular formula | C20H21NO4 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl(113C)butanoic acid |
| InChIKey | UGNIYGNGCNXHTR-ZLHLYFPTSA-N |
| SMILES | CC(C)[C@@H]([13C](=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)