Products 917562-06-2

CAS 917562-06-2 is the registry number for 3-(9-H-Fluoren-9-ylmethoxycarbonylamino)-pentanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 917562-06-2) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: RUDHGDWNJABZLC-UHFFFAOYSA-N.

Identity
Molecular formulaC20H21NO4
Molecular weight339.4 g/mol
IUPAC name3-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid
InChIKeyRUDHGDWNJABZLC-UHFFFAOYSA-N
SMILESCCC(CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13

Computed by PubChem (NCBI)