CAS 68858-20-8 appears in our catalog under these names: Fmoc-valine, Fmoc–Val–OH, Fmoc–L–Val–OH, Fmoc-L-Val-OH, N-Fmoc-L-valine, 98% . Offered by: TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 100g, 10g, 25g, 500g, 250g, 5g, 0,25kg, 0,1kg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoic acid (CAS 68858-20-8) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoic acid. InChIKey: UGNIYGNGCNXHTR-SFHVURJKSA-N.
| Molecular formula | C20H21NO4 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoic acid |
| InChIKey | UGNIYGNGCNXHTR-SFHVURJKSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)