CAS 832127-84-1 is the registry number for methyl (2S)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl](methyl)amino}propanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoate (CAS 832127-84-1) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: methyl (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoate. InChIKey: LPPAAHQAHBPJDN-ZDUSSCGKSA-N.
| Molecular formula | C20H21NO4 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | methyl (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoate |
| InChIKey | LPPAAHQAHBPJDN-ZDUSSCGKSA-N |
| SMILES | C[C@@H](C(=O)OC)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)