Products 203636-40-2

CAS 203636-40-2 is the registry number for methyl 2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-2-methylpropanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoate (CAS 203636-40-2) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: methyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoate. InChIKey: AHDFYWMNDVEXNE-UHFFFAOYSA-N.

Identity
Molecular formulaC20H21NO4
Molecular weight339.4 g/mol
IUPAC namemethyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoate
InChIKeyAHDFYWMNDVEXNE-UHFFFAOYSA-N
SMILESCC(C)(C(=O)OC)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13

Computed by PubChem (NCBI)