CAS 28664-02-0 appears in our catalog under these names: 3-(Carboxymethyl)-2,2-dimethylcyclobutanecarboxylic acid, 97%, Pinic Acid (Diastereomeric Mixture), >95% (HPLC), Pinic Acid, Pinic Acid (Diastereomeric Mixture), ≥95%, Mixture of Diastereomers, ≥95%, Mixture of Diastereomers. Offered by: Chemat Brand, TRC, GLPBio, Chemat. Available pack sizes: on request, 500mg, 50mg, 10mg.
3-(carboxymethyl)-2,2-dimethylcyclobutane-1-carboxylic acid (CAS 28664-02-0) is a chemical compound with the molecular formula C9H14O4 and a molecular weight of 186.20 g/mol. IUPAC name: 3-(carboxymethyl)-2,2-dimethylcyclobutane-1-carboxylic acid. InChIKey: LEVONNIFUFSRKZ-UHFFFAOYSA-N.
| Molecular formula | C9H14O4 |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | 3-(carboxymethyl)-2,2-dimethylcyclobutane-1-carboxylic acid |
| InChIKey | LEVONNIFUFSRKZ-UHFFFAOYSA-N |
| SMILES | CC1(C(CC1C(=O)O)CC(=O)O)C |
Computed by PubChem (NCBI)