Products 61774-58-1
CAS 61774-58-1 appears in our catalog under these names: Cis-Pinic Acid, >95% (HPLC), rel-cis-Pinic acid. Offered by: TRC, Chemat, MedChemExpress. Available pack sizes: 500mg, 50mg, 50 mg.
Cis-(1R,3R)-3-(carboxymethyl)-2,2-dimethylcyclobutane-1-carboxylic acid (CAS 61774-58-1) is a chemical compound with the molecular formula C9H14O4 and a molecular weight of 186.20 g/mol. IUPAC name: cis-(1R,3R)-3-(carboxymethyl)-2,2-dimethylcyclobutane-1-carboxylic acid. InChIKey: LEVONNIFUFSRKZ-RITPCOANSA-N.
| Molecular formula | C9H14O4 |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | cis-(1R,3R)-3-(carboxymethyl)-2,2-dimethylcyclobutane-1-carboxylic acid |
| InChIKey | LEVONNIFUFSRKZ-RITPCOANSA-N |
| SMILES | CC1([C@H](C[C@H]1C(=O)O)CC(=O)O)C |
Computed by PubChem (NCBI)