Products 28664-60-0
CAS 28664-60-0 appears in our catalog under these names: 2',3'-Dehydromarmesin, 2′,3′-Dehydromarmesin. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 50mg, Get quote.
2-(2-hydroxypropan-2-yl)furo[3,2-g]chromen-7-one (CAS 28664-60-0) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: 2-(2-hydroxypropan-2-yl)furo[3,2-g]chromen-7-one. InChIKey: QITAPBJXOHCHQR-UHFFFAOYSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | 2-(2-hydroxypropan-2-yl)furo[3,2-g]chromen-7-one |
| InChIKey | QITAPBJXOHCHQR-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC2=C(O1)C=C3C(=C2)C=CC(=O)O3)O |
Computed by PubChem (NCBI)