CAS 28710-97-6 appears in our catalog under these names: 5-Amino-2-phenyl-2,3-dihydro-1h-pyrazol-3-one, 95%, 5-Amino-2-phenyl-1,2-dihydropyrazol-3-one, 95%, 1-Phenyl-3-aminopyrazol-5-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 25g, 50g, 100g, 250g, 500g.
5-amino-2-phenyl-1H-pyrazol-3-one (CAS 28710-97-6) is a chemical compound with the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. IUPAC name: 5-amino-2-phenyl-1H-pyrazol-3-one. InChIKey: PVKNQGWSRAGMNM-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 5-amino-2-phenyl-1H-pyrazol-3-one |
| InChIKey | PVKNQGWSRAGMNM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C=C(N2)N |
Computed by PubChem (NCBI)