CAS 28721-19-9 is the registry number for 4,4-Dimethyl-3,4-dihydroquinazolin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,4-dimethyl-1,3-dihydroquinazolin-2-one (CAS 28721-19-9) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 4,4-dimethyl-1,3-dihydroquinazolin-2-one. InChIKey: QAENFGLSHOAYSC-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 4,4-dimethyl-1,3-dihydroquinazolin-2-one |
| InChIKey | QAENFGLSHOAYSC-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2NC(=O)N1)C |
Computed by PubChem (NCBI)