CAS 28735-09-3 is the registry number for 4-Chloroquinazolin-2-ol, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-chloro-3H-quinazolin-2-one (CAS 28735-09-3) is a chemical compound with the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. IUPAC name: 4-chloro-3H-quinazolin-2-one. InChIKey: KRHIRJLGBOGLNS-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 4-chloro-3H-quinazolin-2-one |
| InChIKey | KRHIRJLGBOGLNS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NC(=O)N=C2C=C1)Cl |
Computed by PubChem (NCBI)