CAS 28737-34-0 appears in our catalog under these names: 3-FORMYL-1H-INDOLE-2-CARBOXYLIC ACID, 95+%, 95+%, 3-formyl-1H-indole-2-carboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
3-formyl-1H-indole-2-carboxylic acid (CAS 28737-34-0) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 3-formyl-1H-indole-2-carboxylic acid. InChIKey: PRFDLSPESODVAW-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 3-formyl-1H-indole-2-carboxylic acid |
| InChIKey | PRFDLSPESODVAW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)C(=O)O)C=O |
Computed by PubChem (NCBI)