Products 287389-35-9
CAS 287389-35-9 is the registry number for 3-Hydroxybutyric acid-13C2 (sodium). Offered by: MedChemExpress. Available pack sizes: 1 mg.
Sodium 3-hydroxy(2,4-13C2)butanoate (CAS 287389-35-9) is a chemical compound with the molecular formula C4H7NaO3 and a molecular weight of 128.07 g/mol. IUPAC name: sodium 3-hydroxy(2,4-13C2)butanoate. InChIKey: NBPUSGBJDWCHKC-AWQJXPNKSA-M.
| Molecular formula | C4H7NaO3 |
|---|---|
| Molecular weight | 128.07 g/mol |
| IUPAC name | sodium 3-hydroxy(2,4-13C2)butanoate |
| InChIKey | NBPUSGBJDWCHKC-AWQJXPNKSA-M |
| SMILES | [13CH3]C([13CH2]C(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)