Products 2876-78-0
CAS 2876-78-0 appears in our catalog under these names: Methyl 1-Naphthaleneacetate, >95% (GC), 1-Naphthyl acetic acid-methyl ester, Methyl 1–naphthaleneacetate, Methyl 1-Naphthaleneacetate, >98.0%(GC), Methyl 1-naphthylacetate 97%. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, TCI, Ambeed. Available pack sizes: 2,5g, 250mg, 500mg, 100g, 25g, 5g, 10g, 50g.
Methyl 2-naphthalen-1-ylacetate (CAS 2876-78-0) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: methyl 2-naphthalen-1-ylacetate. InChIKey: YGGXZTQSGNFKPJ-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | methyl 2-naphthalen-1-ylacetate |
| InChIKey | YGGXZTQSGNFKPJ-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC=CC2=CC=CC=C21 |
Computed by PubChem (NCBI)