CAS 28767-74-0 is the registry number for D-Arabinose Phenylhydrazone. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg.
(2R,3S,4R,5E)-5-(phenylhydrazinylidene)pentane-1,2,3,4-tetrol (CAS 28767-74-0) is a chemical compound with the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. IUPAC name: (2R,3S,4R,5E)-5-(phenylhydrazinylidene)pentane-1,2,3,4-tetrol. InChIKey: UJFBUGYDKFCOBD-LOVNDBIDSA-N.
| Molecular formula | C11H16N2O4 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | (2R,3S,4R,5E)-5-(phenylhydrazinylidene)pentane-1,2,3,4-tetrol |
| InChIKey | UJFBUGYDKFCOBD-LOVNDBIDSA-N |
| SMILES | C1=CC=C(C=C1)N/N=C/[C@H]([C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)