CAS 2880-49-1 appears in our catalog under these names: Heraclenin, Heraclenin/ 98.95% (existing batch purity), (R)-9-((3,3-Dimethyloxiran-2-yl)methoxy)-7H-furo[3,2-g]chromen-7-one, ≥98%, ≥98%, Heraclenin, 99.59%. Offered by: TRC, TargetMol, Chemat, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg, 5 mg.
9-[[(2R)-3,3-dimethyloxiran-2-yl]methoxy]furo[3,2-g]chromen-7-one (CAS 2880-49-1) is a chemical compound with the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. IUPAC name: 9-[[(2R)-3,3-dimethyloxiran-2-yl]methoxy]furo[3,2-g]chromen-7-one. InChIKey: CTJZWFCPUDPLME-LLVKDONJSA-N.
| Molecular formula | C16H14O5 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | 9-[[(2R)-3,3-dimethyloxiran-2-yl]methoxy]furo[3,2-g]chromen-7-one |
| InChIKey | CTJZWFCPUDPLME-LLVKDONJSA-N |
| SMILES | CC1([C@H](O1)COC2=C3C(=CC4=C2OC=C4)C=CC(=O)O3)C |
Computed by PubChem (NCBI)