CAS 288251-66-1 appears in our catalog under these names: 1-(4-Fluorophenyl)-5-methyl-1h-pyrazole-3-carboxylic acid, 95%, 1-(4-Fluorophenyl)-5-methyl-1H-pyrazole-3-carboxylic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
1-(4-fluorophenyl)-5-methylpyrazole-3-carboxylic acid (CAS 288251-66-1) is a chemical compound with the molecular formula C11H9FN2O2 and a molecular weight of 220.20 g/mol. IUPAC name: 1-(4-fluorophenyl)-5-methylpyrazole-3-carboxylic acid. InChIKey: VYEZQNYDNQBJNA-UHFFFAOYSA-N.
| Molecular formula | C11H9FN2O2 |
|---|---|
| Molecular weight | 220.20 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-5-methylpyrazole-3-carboxylic acid |
| InChIKey | VYEZQNYDNQBJNA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)