Products 2883173-82-6
CAS 2883173-82-6 is the registry number for Antitubercular agent-36. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethyl 5-[6-(4-methylanilino)-2-pyridinyl]-1,2-oxazole-3-carboxylate (CAS 2883173-82-6) is a chemical compound with the molecular formula C18H17N3O3 and a molecular weight of 323.3 g/mol. IUPAC name: ethyl 5-[6-(4-methylanilino)-2-pyridinyl]-1,2-oxazole-3-carboxylate. InChIKey: KQDKNNTUMFTCHN-UHFFFAOYSA-N.
| Molecular formula | C18H17N3O3 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | ethyl 5-[6-(4-methylanilino)-2-pyridinyl]-1,2-oxazole-3-carboxylate |
| InChIKey | KQDKNNTUMFTCHN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=C1)C2=NC(=CC=C2)NC3=CC=C(C=C3)C |
Computed by PubChem (NCBI)
Synonyms:
Antitubercular agent-36