Products 2891580-07-5
CAS 2891580-07-5 is the registry number for (1S)-1-methyl-4-methylene-7-(trifluoromethyl)-1H-pyrano[4,3-c]pyridine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(1S)-1-methyl-4-methylidene-7-(trifluoromethyl)-1H-pyrano[4,3-c]pyridine (CAS 2891580-07-5) is a chemical compound with the molecular formula C11H10F3NO and a molecular weight of 229.20 g/mol. IUPAC name: (1S)-1-methyl-4-methylidene-7-(trifluoromethyl)-1H-pyrano[4,3-c]pyridine. InChIKey: IKCGUGWOZWOAGI-ZETCQYMHSA-N.
| Molecular formula | C11H10F3NO |
|---|---|
| Molecular weight | 229.20 g/mol |
| IUPAC name | (1S)-1-methyl-4-methylidene-7-(trifluoromethyl)-1H-pyrano[4,3-c]pyridine |
| InChIKey | IKCGUGWOZWOAGI-ZETCQYMHSA-N |
| SMILES | C[C@H]1C2=CC(=NC=C2C(=C)CO1)C(F)(F)F |
Computed by PubChem (NCBI)