Products 2891597-42-3
CAS 2891597-42-3 is the registry number for methyl 2-methyl-5-nitro-indazole-3-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Methyl 2-methyl-5-nitroindazole-3-carboxylate (CAS 2891597-42-3) is a chemical compound with the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. IUPAC name: methyl 2-methyl-5-nitroindazole-3-carboxylate. InChIKey: NELQUNXIEUTXLS-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O4 |
|---|---|
| Molecular weight | 235.20 g/mol |
| IUPAC name | methyl 2-methyl-5-nitroindazole-3-carboxylate |
| InChIKey | NELQUNXIEUTXLS-UHFFFAOYSA-N |
| SMILES | CN1C(=C2C=C(C=CC2=N1)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)