Products 2891599-41-8
CAS 2891599-41-8 is the registry number for 6-(tert-butoxycarbonylamino)-2-methyl-quinoline-4-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]quinoline-4-carboxylic acid (CAS 2891599-41-8) is a chemical compound with the molecular formula C16H18N2O4 and a molecular weight of 302.32 g/mol. IUPAC name: 2-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]quinoline-4-carboxylic acid. InChIKey: VBQGIJMCHOYVIQ-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O4 |
|---|---|
| Molecular weight | 302.32 g/mol |
| IUPAC name | 2-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]quinoline-4-carboxylic acid |
| InChIKey | VBQGIJMCHOYVIQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=C(C=CC2=N1)NC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)