Products 2891599-60-1
CAS 2891599-60-1 is the registry number for 7-fluoro-5-formyl-chromane-8-carbonitrile, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
7-fluoro-5-formyl-3,4-dihydro-2H-chromene-8-carbonitrile (CAS 2891599-60-1) is a chemical compound with the molecular formula C11H8FNO2 and a molecular weight of 205.18 g/mol. IUPAC name: 7-fluoro-5-formyl-3,4-dihydro-2H-chromene-8-carbonitrile. InChIKey: MLJCYMAINHQYEZ-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO2 |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | 7-fluoro-5-formyl-3,4-dihydro-2H-chromene-8-carbonitrile |
| InChIKey | MLJCYMAINHQYEZ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=C(C=C2C=O)F)C#N)OC1 |
Computed by PubChem (NCBI)