CAS 2892117-29-0 is the registry number for 4-Methyl-4-((1-methylcyclopropyl)methyl)-1,2,3-oxathiazolidine 2,2-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methyl-4-[(1-methylcyclopropyl)methyl]oxathiazolidine 2,2-dioxide (CAS 2892117-29-0) is a chemical compound with the molecular formula C8H15NO3S and a molecular weight of 205.28 g/mol. IUPAC name: 4-methyl-4-[(1-methylcyclopropyl)methyl]oxathiazolidine 2,2-dioxide. InChIKey: DPSBYZNWJXCEOW-UHFFFAOYSA-N.
| Molecular formula | C8H15NO3S |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | 4-methyl-4-[(1-methylcyclopropyl)methyl]oxathiazolidine 2,2-dioxide |
| InChIKey | DPSBYZNWJXCEOW-UHFFFAOYSA-N |
| SMILES | CC1(CC1)CC2(COS(=O)(=O)N2)C |
Computed by PubChem (NCBI)