CAS 2894-51-1 appears in our catalog under these names: 2–Amino–4'–chlorobenzophenone, 2-Amino-4'-chlorobenzophenone, >98.0%(GC)(T), (2-Aminophenyl)(4-chlorophenyl)methanone, 95%. Offered by: GLPBio, TCI, Fluorochem. Available pack sizes: 100g, 25g, 5g, 10g.
(2-aminophenyl)-(4-chlorophenyl)methanone (CAS 2894-51-1) is a chemical compound with the molecular formula C13H10ClNO and a molecular weight of 231.68 g/mol. IUPAC name: (2-aminophenyl)-(4-chlorophenyl)methanone. InChIKey: APHLSUBLNQBFTM-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO |
|---|---|
| Molecular weight | 231.68 g/mol |
| IUPAC name | (2-aminophenyl)-(4-chlorophenyl)methanone |
| InChIKey | APHLSUBLNQBFTM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)