CAS 289725-22-0 is the registry number for 1-Methylindoline-7-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
1-methyl-2,3-dihydroindole-7-carboxylic acid (CAS 289725-22-0) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 1-methyl-2,3-dihydroindole-7-carboxylic acid. InChIKey: PJFAEBNNBMCYHS-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 1-methyl-2,3-dihydroindole-7-carboxylic acid |
| InChIKey | PJFAEBNNBMCYHS-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C1C(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)