CAS 2899345-92-5 is the registry number for 2,2-Dimethyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-7-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dimethyl-3H-[1,4]dioxino[2,3-b]pyridine-7-carboxylic acid (CAS 2899345-92-5) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: 2,2-dimethyl-3H-[1,4]dioxino[2,3-b]pyridine-7-carboxylic acid. InChIKey: NOMMZVJSTCDBHR-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | 2,2-dimethyl-3H-[1,4]dioxino[2,3-b]pyridine-7-carboxylic acid |
| InChIKey | NOMMZVJSTCDBHR-UHFFFAOYSA-N |
| SMILES | CC1(COC2=C(O1)C=C(C=N2)C(=O)O)C |
Computed by PubChem (NCBI)