Products 2899345-92-5

CAS 2899345-92-5 is the registry number for 2,2-Dimethyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-7-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,2-dimethyl-3H-[1,4]dioxino[2,3-b]pyridine-7-carboxylic acid (CAS 2899345-92-5) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: 2,2-dimethyl-3H-[1,4]dioxino[2,3-b]pyridine-7-carboxylic acid. InChIKey: NOMMZVJSTCDBHR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11NO4
Molecular weight209.20 g/mol
IUPAC name2,2-dimethyl-3H-[1,4]dioxino[2,3-b]pyridine-7-carboxylic acid
InChIKeyNOMMZVJSTCDBHR-UHFFFAOYSA-N
SMILESCC1(COC2=C(O1)C=C(C=N2)C(=O)O)C

Computed by PubChem (NCBI)