Products 2901-78-2
CAS 2901-78-2 appears in our catalog under these names: Levodopa Impurity 9, N-Benzoyl-3-methoxytyrosine. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
2-benzamido-3-(4-hydroxy-3-methoxyphenyl)propanoic acid (CAS 2901-78-2) is a chemical compound with the molecular formula C17H17NO5 and a molecular weight of 315.32 g/mol. IUPAC name: 2-benzamido-3-(4-hydroxy-3-methoxyphenyl)propanoic acid. InChIKey: ODTCNJWUFHCFJB-UHFFFAOYSA-N.
| Molecular formula | C17H17NO5 |
|---|---|
| Molecular weight | 315.32 g/mol |
| IUPAC name | 2-benzamido-3-(4-hydroxy-3-methoxyphenyl)propanoic acid |
| InChIKey | ODTCNJWUFHCFJB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)CC(C(=O)O)NC(=O)C2=CC=CC=C2)O |
Computed by PubChem (NCBI)