Products 2901082-68-4

CAS 2901082-68-4 is the registry number for 2-Fluoro-5-(methoxymethoxy)-3-methylbenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-fluoro-5-(methoxymethoxy)-3-methylbenzoic acid (CAS 2901082-68-4) is a chemical compound with the molecular formula C10H11FO4 and a molecular weight of 214.19 g/mol. IUPAC name: 2-fluoro-5-(methoxymethoxy)-3-methylbenzoic acid. InChIKey: YRADVHKRBWDKAL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11FO4
Molecular weight214.19 g/mol
IUPAC name2-fluoro-5-(methoxymethoxy)-3-methylbenzoic acid
InChIKeyYRADVHKRBWDKAL-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1F)C(=O)O)OCOC

Computed by PubChem (NCBI)