Products 2901082-69-5
CAS 2901082-69-5 is the registry number for 3-Bromo-2-fluoro-4'-methoxy-1,1'-biphenyl, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-2-fluoro-3-(4-methoxyphenyl)benzene (CAS 2901082-69-5) is a chemical compound with the molecular formula C13H10BrFO and a molecular weight of 281.12 g/mol. IUPAC name: 1-bromo-2-fluoro-3-(4-methoxyphenyl)benzene. InChIKey: VASVFHRHOAXXAQ-UHFFFAOYSA-N.
| Molecular formula | C13H10BrFO |
|---|---|
| Molecular weight | 281.12 g/mol |
| IUPAC name | 1-bromo-2-fluoro-3-(4-methoxyphenyl)benzene |
| InChIKey | VASVFHRHOAXXAQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C(=CC=C2)Br)F |
Computed by PubChem (NCBI)