Products 2901083-50-7
CAS 2901083-50-7 is the registry number for 1-(5-bromo-2,3,4-trifluorophenyl)-2-methylpropan-1-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(5-bromo-2,3,4-trifluorophenyl)-2-methylpropan-1-ol (CAS 2901083-50-7) is a chemical compound with the molecular formula C10H10BrF3O and a molecular weight of 283.08 g/mol. IUPAC name: 1-(5-bromo-2,3,4-trifluorophenyl)-2-methylpropan-1-ol. InChIKey: IWCIHPUIBWPFPB-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF3O |
|---|---|
| Molecular weight | 283.08 g/mol |
| IUPAC name | 1-(5-bromo-2,3,4-trifluorophenyl)-2-methylpropan-1-ol |
| InChIKey | IWCIHPUIBWPFPB-UHFFFAOYSA-N |
| SMILES | CC(C)C(C1=CC(=C(C(=C1F)F)F)Br)O |
Computed by PubChem (NCBI)